Products 69971-38-6

CAS 69971-38-6 is the registry number for Methyl 4,6-dimethylpyridine-2-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Methyl 4,6-dimethylpyridine-2-carboxylate (CAS 69971-38-6) is a chemical compound with the molecular formula C9H11NO2 and a molecular weight of 165.19 g/mol. IUPAC name: methyl 4,6-dimethylpyridine-2-carboxylate. InChIKey: ZATJRKPUGUEWGE-UHFFFAOYSA-N.

Identity
Molecular formulaC9H11NO2
Molecular weight165.19 g/mol
IUPAC namemethyl 4,6-dimethylpyridine-2-carboxylate
InChIKeyZATJRKPUGUEWGE-UHFFFAOYSA-N
SMILESCC1=CC(=NC(=C1)C(=O)OC)C

Computed by PubChem (NCBI)