CAS 700860-10-2 is the registry number for Ethyl 2-(5-bromo-4-formyl-2-methoxyphenoxy)propanoate. Offered by: Biosynth. Available pack sizes: 0,5g, 5g.
Ethyl 2-(5-bromo-4-formyl-2-methoxyphenoxy)propanoate (CAS 700860-10-2) is a chemical compound with the molecular formula C13H15BrO5 and a molecular weight of 331.16 g/mol. IUPAC name: ethyl 2-(5-bromo-4-formyl-2-methoxyphenoxy)propanoate. InChIKey: QZFNJVATOUTMIP-UHFFFAOYSA-N.
| Molecular formula | C13H15BrO5 |
|---|---|
| Molecular weight | 331.16 g/mol |
| IUPAC name | ethyl 2-(5-bromo-4-formyl-2-methoxyphenoxy)propanoate |
| InChIKey | QZFNJVATOUTMIP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C)OC1=C(C=C(C(=C1)Br)C=O)OC |
Computed by PubChem (NCBI)