Products 700860-10-2

CAS 700860-10-2 is the registry number for Ethyl 2-(5-bromo-4-formyl-2-methoxyphenoxy)propanoate. Offered by: Biosynth. Available pack sizes: 0,5g, 5g.

Structural formula: {0} (CAS {1})

Ethyl 2-(5-bromo-4-formyl-2-methoxyphenoxy)propanoate (CAS 700860-10-2) is a chemical compound with the molecular formula C13H15BrO5 and a molecular weight of 331.16 g/mol. IUPAC name: ethyl 2-(5-bromo-4-formyl-2-methoxyphenoxy)propanoate. InChIKey: QZFNJVATOUTMIP-UHFFFAOYSA-N.

Identity
Molecular formulaC13H15BrO5
Molecular weight331.16 g/mol
IUPAC nameethyl 2-(5-bromo-4-formyl-2-methoxyphenoxy)propanoate
InChIKeyQZFNJVATOUTMIP-UHFFFAOYSA-N
SMILESCCOC(=O)C(C)OC1=C(C=C(C(=C1)Br)C=O)OC

Computed by PubChem (NCBI)