Products 708292-18-6

CAS 708292-18-6 is the registry number for Methyl 2-(2-bromo-6-ethoxy-4-formylphenoxy)propanoate. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

Methyl 2-(2-bromo-6-ethoxy-4-formylphenoxy)propanoate (CAS 708292-18-6) is a chemical compound with the molecular formula C13H15BrO5 and a molecular weight of 331.16 g/mol. IUPAC name: methyl 2-(2-bromo-6-ethoxy-4-formylphenoxy)propanoate. InChIKey: KESJREQXWPBFRJ-UHFFFAOYSA-N.

Identity
Molecular formulaC13H15BrO5
Molecular weight331.16 g/mol
IUPAC namemethyl 2-(2-bromo-6-ethoxy-4-formylphenoxy)propanoate
InChIKeyKESJREQXWPBFRJ-UHFFFAOYSA-N
SMILESCCOC1=C(C(=CC(=C1)C=O)Br)OC(C)C(=O)OC

Computed by PubChem (NCBI)