CAS 708292-18-6 is the registry number for Methyl 2-(2-bromo-6-ethoxy-4-formylphenoxy)propanoate. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
Methyl 2-(2-bromo-6-ethoxy-4-formylphenoxy)propanoate (CAS 708292-18-6) is a chemical compound with the molecular formula C13H15BrO5 and a molecular weight of 331.16 g/mol. IUPAC name: methyl 2-(2-bromo-6-ethoxy-4-formylphenoxy)propanoate. InChIKey: KESJREQXWPBFRJ-UHFFFAOYSA-N.
| Molecular formula | C13H15BrO5 |
|---|---|
| Molecular weight | 331.16 g/mol |
| IUPAC name | methyl 2-(2-bromo-6-ethoxy-4-formylphenoxy)propanoate |
| InChIKey | KESJREQXWPBFRJ-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C(=CC(=C1)C=O)Br)OC(C)C(=O)OC |
Computed by PubChem (NCBI)