Products 70101-24-5
CAS 70101-24-5 is the registry number for Diethylstilbestrol Impurity 4. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
[(2Z,4Z)-3,4-bis(4-acetyloxyphenyl)hexa-2,4-dienyl] acetate (CAS 70101-24-5) is a chemical compound with the molecular formula C24H24O6 and a molecular weight of 408.4 g/mol. IUPAC name: [(2Z,4Z)-3,4-bis(4-acetyloxyphenyl)hexa-2,4-dienyl] acetate. InChIKey: IXMLDOABYANMNR-LRFLAKLXSA-N.
| Molecular formula | C24H24O6 |
|---|---|
| Molecular weight | 408.4 g/mol |
| IUPAC name | [(2Z,4Z)-3,4-bis(4-acetyloxyphenyl)hexa-2,4-dienyl] acetate |
| InChIKey | IXMLDOABYANMNR-LRFLAKLXSA-N |
| SMILES | C/C=C(/C1=CC=C(C=C1)OC(=O)C)\C(=C/COC(=O)C)\C2=CC=C(C=C2)OC(=O)C |
Computed by PubChem (NCBI)