Products 864516-31-4
CAS 864516-31-4 is the registry number for Nigrolineaxanthone V. Offered by: MedChemExpress. Available pack sizes: 1 mg.
7,12-dihydroxy-9-methoxy-2,2-dimethyl-10-(3-methylbut-2-enyl)pyrano[3,2-b]xanthen-6-one (CAS 864516-31-4) is a chemical compound with the molecular formula C24H24O6 and a molecular weight of 408.4 g/mol. IUPAC name: 7,12-dihydroxy-9-methoxy-2,2-dimethyl-10-(3-methylbut-2-enyl)pyrano[3,2-b]xanthen-6-one. InChIKey: OCYZJBDJUYIHMM-UHFFFAOYSA-N.
| Molecular formula | C24H24O6 |
|---|---|
| Molecular weight | 408.4 g/mol |
| IUPAC name | 7,12-dihydroxy-9-methoxy-2,2-dimethyl-10-(3-methylbut-2-enyl)pyrano[3,2-b]xanthen-6-one |
| InChIKey | OCYZJBDJUYIHMM-UHFFFAOYSA-N |
| SMILES | CC(=CCC1=C(C=C(C2=C1OC3=C(C2=O)C=C4C=CC(OC4=C3O)(C)C)O)OC)C |
Computed by PubChem (NCBI)
Synonyms:
Nigrolineaxanthone V, orb1682013