CAS 70138-72-6 appears in our catalog under these names: Boc-D-Pro-NH2 97%, (R)-tert-Butyl 2-carbamoylpyrrolidine-1-carboxylate, 97%, 97%, D-1-N-Boc-Prolinamide, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 50g, 250g, 500g.
Tert-butyl (2R)-2-carbamoylpyrrolidine-1-carboxylate (CAS 70138-72-6) is a chemical compound with the molecular formula C10H18N2O3 and a molecular weight of 214.26 g/mol. IUPAC name: tert-butyl (2R)-2-carbamoylpyrrolidine-1-carboxylate. InChIKey: PITJAAIPVBVRAO-SSDOTTSWSA-N.
| Molecular formula | C10H18N2O3 |
|---|---|
| Molecular weight | 214.26 g/mol |
| IUPAC name | tert-butyl (2R)-2-carbamoylpyrrolidine-1-carboxylate |
| InChIKey | PITJAAIPVBVRAO-SSDOTTSWSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H]1C(=O)N |
Computed by PubChem (NCBI)