CAS 7015-20-5 appears in our catalog under these names: Deschloronorketamine (hydrochloride), Deschloronorketamine Hydrochloride, Deschloronorketamine (hydrochloride). Offered by: GLPBio, TRC, Biosynth, MedChemExpress. Available pack sizes: 5mg, 250mg, 1mg, 25mg, 10mg, 50mg, 5 mg, 1 mg.
2-amino-2-phenylcyclohexan-1-one (CAS 7015-20-5) is a chemical compound with the molecular formula C12H15NO and a molecular weight of 189.25 g/mol. IUPAC name: 2-amino-2-phenylcyclohexan-1-one. InChIKey: IXDGGSSUYSFGOK-UHFFFAOYSA-N.
| Molecular formula | C12H15NO |
|---|---|
| Molecular weight | 189.25 g/mol |
| IUPAC name | 2-amino-2-phenylcyclohexan-1-one |
| InChIKey | IXDGGSSUYSFGOK-UHFFFAOYSA-N |
| SMILES | C1CCC(C(=O)C1)(C2=CC=CC=C2)N |
Computed by PubChem (NCBI)