CAS 7015-25-0 appears in our catalog under these names: 2-Phenylcyclopentanecarboxylic acid, 95+%, 2-Phenylcyclopentane-1-carboxylic acid, 2-Phenylcyclopentanecarboxylic acid, 95+%, 95+%, 2-Phenylcyclopentane-1-carboxylic acid, 95+%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 0,5g, 50mg, 100mg, 250mg.
2-phenylcyclopentane-1-carboxylic acid (CAS 7015-25-0) is a chemical compound with the molecular formula C12H14O2 and a molecular weight of 190.24 g/mol. IUPAC name: 2-phenylcyclopentane-1-carboxylic acid. InChIKey: CINPEFPDYGSEDP-UHFFFAOYSA-N.
| Molecular formula | C12H14O2 |
|---|---|
| Molecular weight | 190.24 g/mol |
| IUPAC name | 2-phenylcyclopentane-1-carboxylic acid |
| InChIKey | CINPEFPDYGSEDP-UHFFFAOYSA-N |
| SMILES | C1CC(C(C1)C(=O)O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)