CAS 70172-31-5 is the registry number for Diclofenac sodium Impurity 41. Offered by: Chemat Brand. Available pack sizes: on request.
2-[2-(2,4-dichloroanilino)phenyl]acetic acid (CAS 70172-31-5) is a chemical compound with the molecular formula C14H11Cl2NO2 and a molecular weight of 296.1 g/mol. IUPAC name: 2-[2-(2,4-dichloroanilino)phenyl]acetic acid. InChIKey: GKMRVTQGGLGLCX-UHFFFAOYSA-N.
| Molecular formula | C14H11Cl2NO2 |
|---|---|
| Molecular weight | 296.1 g/mol |
| IUPAC name | 2-[2-(2,4-dichloroanilino)phenyl]acetic acid |
| InChIKey | GKMRVTQGGLGLCX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CC(=O)O)NC2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)