CAS 701899-34-5 is the registry number for 10-O-Benzyl (R)-Apomorphine. Offered by: TRC. Available pack sizes: 100mg.
(6aR)-6-methyl-10-phenylmethoxy-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-11-ol (CAS 701899-34-5) is a chemical compound with the molecular formula C24H23NO2 and a molecular weight of 357.4 g/mol. IUPAC name: (6aR)-6-methyl-10-phenylmethoxy-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-11-ol. InChIKey: VQKVWUVMSPTJFS-HXUWFJFHSA-N.
| Molecular formula | C24H23NO2 |
|---|---|
| Molecular weight | 357.4 g/mol |
| IUPAC name | (6aR)-6-methyl-10-phenylmethoxy-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-11-ol |
| InChIKey | VQKVWUVMSPTJFS-HXUWFJFHSA-N |
| SMILES | CN1CCC2=C3[C@H]1CC4=C(C3=CC=C2)C(=C(C=C4)OCC5=CC=CC=C5)O |
Computed by PubChem (NCBI)