Products 70205-50-4
CAS 70205-50-4 is the registry number for Pyruvate Carboxylase-IN-1, 99.43%. Offered by: MedChemExpress. Available pack sizes: 5 mg, 25 mg, 50 mg, 10 mg, 1 mg.
2-methoxy-9,10-dihydrophenanthrene-4,5-diol (CAS 70205-50-4) is a chemical compound with the molecular formula C15H14O3 and a molecular weight of 242.27 g/mol. IUPAC name: 2-methoxy-9,10-dihydrophenanthrene-4,5-diol. InChIKey: KQMGXHNRKZYDEK-UHFFFAOYSA-N.
| Molecular formula | C15H14O3 |
|---|---|
| Molecular weight | 242.27 g/mol |
| IUPAC name | 2-methoxy-9,10-dihydrophenanthrene-4,5-diol |
| InChIKey | KQMGXHNRKZYDEK-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C(=C1)O)C3=C(CC2)C=CC=C3O |
Computed by PubChem (NCBI)