CAS 702642-03-3 appears in our catalog under these names: 3-Ethyl-2-nitroaniline, 98%, 3-Ethyl-2-nitroaniline, 95%, 95%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg.
3-ethyl-2-nitroaniline (CAS 702642-03-3) is a chemical compound with the molecular formula C8H10N2O2 and a molecular weight of 166.18 g/mol. IUPAC name: 3-ethyl-2-nitroaniline. InChIKey: XMTQIKUKTIVHEJ-UHFFFAOYSA-N.
| Molecular formula | C8H10N2O2 |
|---|---|
| Molecular weight | 166.18 g/mol |
| IUPAC name | 3-ethyl-2-nitroaniline |
| InChIKey | XMTQIKUKTIVHEJ-UHFFFAOYSA-N |
| SMILES | CCC1=C(C(=CC=C1)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)