CAS 70334-60-0 appears in our catalog under these names: 1-(3-Azidophenyl) Ethan-1-One, 1-(3-Azidophenyl)ethan-1-one. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 500mg.
1-(3-azidophenyl)ethanone (CAS 70334-60-0) is a chemical compound with the molecular formula C8H7N3O and a molecular weight of 161.16 g/mol. IUPAC name: 1-(3-azidophenyl)ethanone. InChIKey: HANPLRJJHYSJSF-UHFFFAOYSA-N.
| Molecular formula | C8H7N3O |
|---|---|
| Molecular weight | 161.16 g/mol |
| IUPAC name | 1-(3-azidophenyl)ethanone |
| InChIKey | HANPLRJJHYSJSF-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=CC=C1)N=[N+]=[N-] |
Computed by PubChem (NCBI)