CAS 7039-74-9 is the registry number for 2-Bromo-1-(5-chloro-1-benzofuran-2-yl)ethan-1-one. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
2-bromo-1-(5-chloro-1-benzofuran-2-yl)ethanone (CAS 7039-74-9) is a chemical compound with the molecular formula C10H6BrClO2 and a molecular weight of 273.51 g/mol. IUPAC name: 2-bromo-1-(5-chloro-1-benzofuran-2-yl)ethanone. InChIKey: VPUBAVYOQQLHPM-UHFFFAOYSA-N.
| Molecular formula | C10H6BrClO2 |
|---|---|
| Molecular weight | 273.51 g/mol |
| IUPAC name | 2-bromo-1-(5-chloro-1-benzofuran-2-yl)ethanone |
| InChIKey | VPUBAVYOQQLHPM-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)C=C(O2)C(=O)CBr |
Computed by PubChem (NCBI)