CAS 70391-08-1 is the registry number for 5-Phenyl-1,3,4-thiadiazole-2-carbonitrile, 95%. Offered by: AmBeed. Available pack sizes: 1g.
5-phenyl-1,3,4-thiadiazole-2-carbonitrile (CAS 70391-08-1) is a chemical compound with the molecular formula C9H5N3S and a molecular weight of 187.22 g/mol. IUPAC name: 5-phenyl-1,3,4-thiadiazole-2-carbonitrile. InChIKey: BZAZAADJISYHGV-UHFFFAOYSA-N.
| Molecular formula | C9H5N3S |
|---|---|
| Molecular weight | 187.22 g/mol |
| IUPAC name | 5-phenyl-1,3,4-thiadiazole-2-carbonitrile |
| InChIKey | BZAZAADJISYHGV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NN=C(S2)C#N |
Computed by PubChem (NCBI)