CAS 82894-99-3 appears in our catalog under these names: 4-(1,2,3-Thiadiazol-4-yl)benzonitrile, 97%, 4-(1,2,3-Thiadiazol-4-yl)benzonitrile. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
4-(thiadiazol-4-yl)benzonitrile (CAS 82894-99-3) is a chemical compound with the molecular formula C9H5N3S and a molecular weight of 187.22 g/mol. IUPAC name: 4-(thiadiazol-4-yl)benzonitrile. InChIKey: LOLQDXFKXGCNFZ-UHFFFAOYSA-N.
| Molecular formula | C9H5N3S |
|---|---|
| Molecular weight | 187.22 g/mol |
| IUPAC name | 4-(thiadiazol-4-yl)benzonitrile |
| InChIKey | LOLQDXFKXGCNFZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C#N)C2=CSN=N2 |
Computed by PubChem (NCBI)