Products 70416-50-1
CAS 70416-50-1 appears in our catalog under these names: 6-Bromo-5-cyano-nicotinic acid ethyl ester, 95%, Ethyl 6-bromo-5-cyanonicotinate, 95+%, 6–Bromo–5–Cyano–Nicotinic Acid Ethyl Ester. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
Ethyl 6-bromo-5-cyanopyridine-3-carboxylate (CAS 70416-50-1) is a chemical compound with the molecular formula C9H7BrN2O2 and a molecular weight of 255.07 g/mol. IUPAC name: ethyl 6-bromo-5-cyanopyridine-3-carboxylate. InChIKey: NLVAXXCWCXUUDI-UHFFFAOYSA-N.
| Molecular formula | C9H7BrN2O2 |
|---|---|
| Molecular weight | 255.07 g/mol |
| IUPAC name | ethyl 6-bromo-5-cyanopyridine-3-carboxylate |
| InChIKey | NLVAXXCWCXUUDI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(N=C1)Br)C#N |
Computed by PubChem (NCBI)