Products 70434-83-2
CAS 70434-83-2 appears in our catalog under these names: (±)–epi CP 47,497 (exempt preparation), (±)-Epi cp 47,497. Offered by: GLPBio, Biosynth. Available pack sizes: 10mg, 25mg, 5mg, 100mg, 50mg.
2-[(1S,3S)-3-hydroxycyclohexyl]-5-(2-methyloctan-2-yl)phenol (CAS 70434-83-2) is a chemical compound with the molecular formula C21H34O2 and a molecular weight of 318.5 g/mol. IUPAC name: 2-[(1S,3S)-3-hydroxycyclohexyl]-5-(2-methyloctan-2-yl)phenol. InChIKey: ZWWRREXSUJTKNN-WMZOPIPTSA-N.
| Molecular formula | C21H34O2 |
|---|---|
| Molecular weight | 318.5 g/mol |
| IUPAC name | 2-[(1S,3S)-3-hydroxycyclohexyl]-5-(2-methyloctan-2-yl)phenol |
| InChIKey | ZWWRREXSUJTKNN-WMZOPIPTSA-N |
| SMILES | CCCCCCC(C)(C)C1=CC(=C(C=C1)[C@H]2CCC[C@@H](C2)O)O |
Computed by PubChem (NCBI)