CAS 705-33-9 is the registry number for 4-Ethenylbenzene-1-sulfonyl fluoride, 95% +(stabilized with TBC). Offered by: AmBeed. Available pack sizes: 5g.
4-ethenylbenzenesulfonyl fluoride (CAS 705-33-9) is a chemical compound with the molecular formula C8H7FO2S and a molecular weight of 186.21 g/mol. IUPAC name: 4-ethenylbenzenesulfonyl fluoride. InChIKey: AANYPNZHPGEIOT-UHFFFAOYSA-N.
| Molecular formula | C8H7FO2S |
|---|---|
| Molecular weight | 186.21 g/mol |
| IUPAC name | 4-ethenylbenzenesulfonyl fluoride |
| InChIKey | AANYPNZHPGEIOT-UHFFFAOYSA-N |
| SMILES | C=CC1=CC=C(C=C1)S(=O)(=O)F |
Computed by PubChem (NCBI)