Products 705-33-9

CAS 705-33-9 is the registry number for 4-Ethenylbenzene-1-sulfonyl fluoride, 95% +(stabilized with TBC). Offered by: AmBeed. Available pack sizes: 5g.

4-ethenylbenzenesulfonyl fluoride (CAS 705-33-9) is a chemical compound with the molecular formula C8H7FO2S and a molecular weight of 186.21 g/mol. IUPAC name: 4-ethenylbenzenesulfonyl fluoride. InChIKey: AANYPNZHPGEIOT-UHFFFAOYSA-N.

Identity
Molecular formulaC8H7FO2S
Molecular weight186.21 g/mol
IUPAC name4-ethenylbenzenesulfonyl fluoride
InChIKeyAANYPNZHPGEIOT-UHFFFAOYSA-N
SMILESC=CC1=CC=C(C=C1)S(=O)(=O)F

Computed by PubChem (NCBI)