Products 70570-20-6
CAS 70570-20-6 is the registry number for (2E)-3-(3,4-Dimethoxyphenyl)-2-methylprop-2-enoic acid. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
(E)-3-(3,4-dimethoxyphenyl)-2-methylprop-2-enoic acid (CAS 70570-20-6) is a chemical compound with the molecular formula C12H14O4 and a molecular weight of 222.24 g/mol. IUPAC name: (E)-3-(3,4-dimethoxyphenyl)-2-methylprop-2-enoic acid. InChIKey: HWFGFNBLIMJWLY-SOFGYWHQSA-N.
| Molecular formula | C12H14O4 |
|---|---|
| Molecular weight | 222.24 g/mol |
| IUPAC name | (E)-3-(3,4-dimethoxyphenyl)-2-methylprop-2-enoic acid |
| InChIKey | HWFGFNBLIMJWLY-SOFGYWHQSA-N |
| SMILES | C/C(=C\C1=CC(=C(C=C1)OC)OC)/C(=O)O |
Computed by PubChem (NCBI)