CAS 70660-38-7 appears in our catalog under these names: 4–Methyl–2–(1–phenylethyl)aniline, 4-Methyl-2-(1-phenylethyl)aniline, 98%, 98%, Benzenamine, 4-methyl-2-(1-phenylethyl)-, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
4-methyl-2-(1-phenylethyl)aniline (CAS 70660-38-7) is a chemical compound with the molecular formula C15H17N and a molecular weight of 211.30 g/mol. IUPAC name: 4-methyl-2-(1-phenylethyl)aniline. InChIKey: AIENFWPRLIQTLX-UHFFFAOYSA-N.
| Molecular formula | C15H17N |
|---|---|
| Molecular weight | 211.30 g/mol |
| IUPAC name | 4-methyl-2-(1-phenylethyl)aniline |
| InChIKey | AIENFWPRLIQTLX-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)N)C(C)C2=CC=CC=C2 |
Computed by PubChem (NCBI)