CAS 70758-25-7 is the registry number for 5–Amino–1H–isochromen–1–one. Offered by: GLPBio. Available pack sizes: 1g.
5-aminoisochromen-1-one (CAS 70758-25-7) is a chemical compound with the molecular formula C9H7NO2 and a molecular weight of 161.16 g/mol. IUPAC name: 5-aminoisochromen-1-one. InChIKey: OFELFQJDRMOISA-UHFFFAOYSA-N.
| Molecular formula | C9H7NO2 |
|---|---|
| Molecular weight | 161.16 g/mol |
| IUPAC name | 5-aminoisochromen-1-one |
| InChIKey | OFELFQJDRMOISA-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=COC2=O)C(=C1)N |
Computed by PubChem (NCBI)