CAS 708291-98-9 is the registry number for 2-Methyl-5-(3-methyl[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)aniline, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-methyl-5-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)aniline (CAS 708291-98-9) is a chemical compound with the molecular formula C11H11N5S and a molecular weight of 245.31 g/mol. IUPAC name: 2-methyl-5-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)aniline. InChIKey: MOQIBEHXBVLKRN-UHFFFAOYSA-N.
| Molecular formula | C11H11N5S |
|---|---|
| Molecular weight | 245.31 g/mol |
| IUPAC name | 2-methyl-5-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)aniline |
| InChIKey | MOQIBEHXBVLKRN-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C2=NN3C(=NN=C3S2)C)N |
Computed by PubChem (NCBI)