CAS 792946-08-8 is the registry number for 2-Methyl-3-(3-methyl-[1,2,4]triazolo[3,4-b]-[1,3,4]thiadiazol-6-yl)-phenylamine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-methyl-3-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)aniline (CAS 792946-08-8) is a chemical compound with the molecular formula C11H11N5S and a molecular weight of 245.31 g/mol. IUPAC name: 2-methyl-3-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)aniline. InChIKey: XTONFSXFVGLULD-UHFFFAOYSA-N.
| Molecular formula | C11H11N5S |
|---|---|
| Molecular weight | 245.31 g/mol |
| IUPAC name | 2-methyl-3-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)aniline |
| InChIKey | XTONFSXFVGLULD-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC=C1N)C2=NN3C(=NN=C3S2)C |
Computed by PubChem (NCBI)