Products 7085-93-0

CAS 7085-93-0 is the registry number for 3-(Ethylamino)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg, 5g, 250mg, 10g.

Structural formula: {0} (CAS {1})

3-(ethylamino)benzoic acid (CAS 7085-93-0) is a chemical compound with the molecular formula C9H11NO2 and a molecular weight of 165.19 g/mol. IUPAC name: 3-(ethylamino)benzoic acid. InChIKey: GKEIWXKNDYYAHK-UHFFFAOYSA-N.

Identity
Molecular formulaC9H11NO2
Molecular weight165.19 g/mol
IUPAC name3-(ethylamino)benzoic acid
InChIKeyGKEIWXKNDYYAHK-UHFFFAOYSA-N
SMILESCCNC1=CC=CC(=C1)C(=O)O

Computed by PubChem (NCBI)