Products 70939-97-8
CAS 70939-97-8 appears in our catalog under these names: Ecgonine Ethyl Ester, Ecgonine Ethyl Ester 0.1 mg/ml in Acetonitrile. Offered by: TRC, Mikromol, LoGiCal, Biosynth. Available pack sizes: 10mg, 50mg, 100mg, 1ml, 25mg, 250mg.
Ethyl (1R,2R,3S,5S)-3-hydroxy-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate (CAS 70939-97-8) is a chemical compound with the molecular formula C11H19NO3 and a molecular weight of 213.27 g/mol. IUPAC name: ethyl (1R,2R,3S,5S)-3-hydroxy-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate. InChIKey: ABDMBNAKYBUEEX-QCLAVDOMSA-N.
| Molecular formula | C11H19NO3 |
|---|---|
| Molecular weight | 213.27 g/mol |
| IUPAC name | ethyl (1R,2R,3S,5S)-3-hydroxy-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate |
| InChIKey | ABDMBNAKYBUEEX-QCLAVDOMSA-N |
| SMILES | CCOC(=O)[C@@H]1[C@H]2CC[C@H](N2C)C[C@@H]1O |
Computed by PubChem (NCBI)