CAS 70957-04-9 is the registry number for 1-Pivaloylindole, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 10g, 25g.
1-indol-1-yl-2,2-dimethylpropan-1-one (CAS 70957-04-9) is a chemical compound with the molecular formula C13H15NO and a molecular weight of 201.26 g/mol. IUPAC name: 1-indol-1-yl-2,2-dimethylpropan-1-one. InChIKey: DTRSVKLNWUNCQE-UHFFFAOYSA-N.
| Molecular formula | C13H15NO |
|---|---|
| Molecular weight | 201.26 g/mol |
| IUPAC name | 1-indol-1-yl-2,2-dimethylpropan-1-one |
| InChIKey | DTRSVKLNWUNCQE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)N1C=CC2=CC=CC=C21 |
Computed by PubChem (NCBI)