Products 710329-24-1
CAS 710329-24-1 is the registry number for N-(4-chlorophenyl)(4-(N-(4-chlorophenyl)carbamoyl)(1,4-diazaperhydroepinyl))formamide. Offered by: Biosynth. Available pack sizes: 250mg.
1-N,4-N-bis(4-chlorophenyl)-1,4-diazepane-1,4-dicarboxamide (CAS 710329-24-1) is a chemical compound with the molecular formula C19H20Cl2N4O2 and a molecular weight of 407.3 g/mol. IUPAC name: 1-N,4-N-bis(4-chlorophenyl)-1,4-diazepane-1,4-dicarboxamide. InChIKey: TYHIWMMPSBFXJM-UHFFFAOYSA-N.
| Molecular formula | C19H20Cl2N4O2 |
|---|---|
| Molecular weight | 407.3 g/mol |
| IUPAC name | 1-N,4-N-bis(4-chlorophenyl)-1,4-diazepane-1,4-dicarboxamide |
| InChIKey | TYHIWMMPSBFXJM-UHFFFAOYSA-N |
| SMILES | C1CN(CCN(C1)C(=O)NC2=CC=C(C=C2)Cl)C(=O)NC3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)