Products 710655-15-5
CAS 710655-15-5 appears in our catalog under these names: PF–592379, PF-592379. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 20mg, Get quote.
5-[(2R,5S)-5-methyl-4-propylmorpholin-2-yl]pyridin-2-amine (CAS 710655-15-5) is a chemical compound with the molecular formula C13H21N3O and a molecular weight of 235.33 g/mol. IUPAC name: 5-[(2R,5S)-5-methyl-4-propylmorpholin-2-yl]pyridin-2-amine. InChIKey: DFTCYTDJDXZFSK-JQWIXIFHSA-N.
| Molecular formula | C13H21N3O |
|---|---|
| Molecular weight | 235.33 g/mol |
| IUPAC name | 5-[(2R,5S)-5-methyl-4-propylmorpholin-2-yl]pyridin-2-amine |
| InChIKey | DFTCYTDJDXZFSK-JQWIXIFHSA-N |
| SMILES | CCCN1C[C@H](OC[C@@H]1C)C2=CN=C(C=C2)N |
Computed by PubChem (NCBI)