CAS 711017-85-5 appears in our catalog under these names: Boc-(2S)-Gly-4-pyranoyl, 97%, (S)–2–(tert–Butoxycarbonylamino)–2–(tetrahydro–2H–pyran–4–yl)acetic acid, Boc-4-Pyranoyl-Gly-OH 95%, (S)-2-((tert-Butoxycarbonyl)amino)-2-(tetrahydro-2H-pyran-4-yl)acetic acid, >95%, >95%, Boc-(2S)-Gly-4-pyranoyl, 97.0%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1g, 250mg, 5g, 100mg, 250 mg, 100 mg, 500 mg, 1 g.
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(oxan-4-yl)acetic acid (CAS 711017-85-5) is a chemical compound with the molecular formula C12H21NO5 and a molecular weight of 259.30 g/mol. IUPAC name: (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(oxan-4-yl)acetic acid. InChIKey: MAJWUTNRLZHCBX-VIFPVBQESA-N.
| Molecular formula | C12H21NO5 |
|---|---|
| Molecular weight | 259.30 g/mol |
| IUPAC name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(oxan-4-yl)acetic acid |
| InChIKey | MAJWUTNRLZHCBX-VIFPVBQESA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](C1CCOCC1)C(=O)O |
Computed by PubChem (NCBI)