CAS 71119-75-0 is the registry number for 2-Isocyano-1,4-dimethylbenzene, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-isocyano-1,4-dimethylbenzene (CAS 71119-75-0) is a chemical compound with the molecular formula C9H9N and a molecular weight of 131.17 g/mol. IUPAC name: 2-isocyano-1,4-dimethylbenzene. InChIKey: AQCQQUFIVCZJKV-UHFFFAOYSA-N.
| Molecular formula | C9H9N |
|---|---|
| Molecular weight | 131.17 g/mol |
| IUPAC name | 2-isocyano-1,4-dimethylbenzene |
| InChIKey | AQCQQUFIVCZJKV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C)[N+]#[C-] |
Computed by PubChem (NCBI)