Products 71135-80-3
CAS 71135-80-3 appears in our catalog under these names: Cannithrene 1, Cannithrene 1, ≥98%, ≥98%. Offered by: TRC, Biosynth, Chemat. Available pack sizes: 25mg, 5mg, 1mg, 10mg, 50mg.
7-methoxy-9,10-dihydrophenanthrene-3,5-diol (CAS 71135-80-3) is a chemical compound with the molecular formula C15H14O3 and a molecular weight of 242.27 g/mol. IUPAC name: 7-methoxy-9,10-dihydrophenanthrene-3,5-diol. InChIKey: PLHFLFWGPBWZHL-UHFFFAOYSA-N.
| Molecular formula | C15H14O3 |
|---|---|
| Molecular weight | 242.27 g/mol |
| IUPAC name | 7-methoxy-9,10-dihydrophenanthrene-3,5-diol |
| InChIKey | PLHFLFWGPBWZHL-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C(=C1)O)C3=C(CC2)C=CC(=C3)O |
Computed by PubChem (NCBI)