CAS 7116-34-9 is the registry number for 3-(4-Nitro-phenyl)-propionic acid ethyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Ethyl 3-(4-nitrophenyl)propanoate (CAS 7116-34-9) is a chemical compound with the molecular formula C11H13NO4 and a molecular weight of 223.22 g/mol. IUPAC name: ethyl 3-(4-nitrophenyl)propanoate. InChIKey: QGKUTNMKCRVGRE-UHFFFAOYSA-N.
| Molecular formula | C11H13NO4 |
|---|---|
| Molecular weight | 223.22 g/mol |
| IUPAC name | ethyl 3-(4-nitrophenyl)propanoate |
| InChIKey | QGKUTNMKCRVGRE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CCC1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)