CAS 7137-54-4 appears in our catalog under these names: 1-Nitro-2-propylbenzene, 95%, 1-Nitro-2-propylbenzene, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
1-nitro-2-propylbenzene (CAS 7137-54-4) is a chemical compound with the molecular formula C9H11NO2 and a molecular weight of 165.19 g/mol. IUPAC name: 1-nitro-2-propylbenzene. InChIKey: UGAXDAGIKIVCQB-UHFFFAOYSA-N.
| Molecular formula | C9H11NO2 |
|---|---|
| Molecular weight | 165.19 g/mol |
| IUPAC name | 1-nitro-2-propylbenzene |
| InChIKey | UGAXDAGIKIVCQB-UHFFFAOYSA-N |
| SMILES | CCCC1=CC=CC=C1[N+](=O)[O-] |
Computed by PubChem (NCBI)