Products 71448-11-8
CAS 71448-11-8 appears in our catalog under these names: Bz–Ala–Arg–OH, Bz-Ala-Arg, 98.89%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1g, 250mg, 1 mg, 10 mg, 5 mg.
(2S)-2-[[(2S)-2-benzamidopropanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid (CAS 71448-11-8) is a chemical compound with the molecular formula C16H23N5O4 and a molecular weight of 349.38 g/mol. IUPAC name: (2S)-2-[[(2S)-2-benzamidopropanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid. InChIKey: FDSPJMDEWGLXKT-JQWIXIFHSA-N.
| Molecular formula | C16H23N5O4 |
|---|---|
| Molecular weight | 349.38 g/mol |
| IUPAC name | (2S)-2-[[(2S)-2-benzamidopropanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| InChIKey | FDSPJMDEWGLXKT-JQWIXIFHSA-N |
| SMILES | C[C@@H](C(=O)N[C@@H](CCCN=C(N)N)C(=O)O)NC(=O)C1=CC=CC=C1 |
Computed by PubChem (NCBI)