CAS 7148-24-5 appears in our catalog under these names: N-(4-Nitrobenzoyl)-L-glutamic acid diethyl ester, 95+%, 1,5-Diethyl N-(4-nitrobenzoyl)-L-glutamate, 97%, 97%, N-(4-Nitrobenzoyl)-L-glutamic acid diethyl ester, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
Diethyl (2S)-2-[(4-nitrobenzoyl)amino]pentanedioate (CAS 7148-24-5) is a chemical compound with the molecular formula C16H20N2O7 and a molecular weight of 352.34 g/mol. IUPAC name: diethyl (2S)-2-[(4-nitrobenzoyl)amino]pentanedioate. InChIKey: OTQQWHKIMACEHP-ZDUSSCGKSA-N.
| Molecular formula | C16H20N2O7 |
|---|---|
| Molecular weight | 352.34 g/mol |
| IUPAC name | diethyl (2S)-2-[(4-nitrobenzoyl)amino]pentanedioate |
| InChIKey | OTQQWHKIMACEHP-ZDUSSCGKSA-N |
| SMILES | CCOC(=O)CC[C@@H](C(=O)OCC)NC(=O)C1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)