CAS 716-75-6 appears in our catalog under these names: 4-(3-Fluoro-4-methoxyphenyl)-1,3-thiazol-2-amine, 95%, 4-(3-Fluoro-4-methoxyphenyl)thiazol-2-amine, 97%, 4-(3-Fluoro-4-methoxyphenyl)thiazol-2-ylamine. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
4-(3-fluoro-4-methoxyphenyl)-1,3-thiazol-2-amine (CAS 716-75-6) is a chemical compound with the molecular formula C10H9FN2OS and a molecular weight of 224.26 g/mol. IUPAC name: 4-(3-fluoro-4-methoxyphenyl)-1,3-thiazol-2-amine. InChIKey: YNGDDNXKDDLUAK-UHFFFAOYSA-N.
| Molecular formula | C10H9FN2OS |
|---|---|
| Molecular weight | 224.26 g/mol |
| IUPAC name | 4-(3-fluoro-4-methoxyphenyl)-1,3-thiazol-2-amine |
| InChIKey | YNGDDNXKDDLUAK-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=CSC(=N2)N)F |
Computed by PubChem (NCBI)