Products 926263-12-9
CAS 926263-12-9 is the registry number for 3-Ethyl-6-fluoro-2-sulfanyl-3,4-dihydroquinazolin-4-one. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-ethyl-6-fluoro-2-sulfanylidene-1H-quinazolin-4-one (CAS 926263-12-9) is a chemical compound with the molecular formula C10H9FN2OS and a molecular weight of 224.26 g/mol. IUPAC name: 3-ethyl-6-fluoro-2-sulfanylidene-1H-quinazolin-4-one. InChIKey: FGRJYXLUJMYZOQ-UHFFFAOYSA-N.
| Molecular formula | C10H9FN2OS |
|---|---|
| Molecular weight | 224.26 g/mol |
| IUPAC name | 3-ethyl-6-fluoro-2-sulfanylidene-1H-quinazolin-4-one |
| InChIKey | FGRJYXLUJMYZOQ-UHFFFAOYSA-N |
| SMILES | CCN1C(=O)C2=C(C=CC(=C2)F)NC1=S |
Computed by PubChem (NCBI)