CAS 716344-20-6 appears in our catalog under these names: 4-(3-Fluoro-4-methoxyphenyl)benzaldehyde, 95%, 3'-Fluoro-4'-methoxy-(1,1'-biphenyl)-4-carbaldehyde, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
4-(3-fluoro-4-methoxyphenyl)benzaldehyde (CAS 716344-20-6) is a chemical compound with the molecular formula C14H11FO2 and a molecular weight of 230.23 g/mol. IUPAC name: 4-(3-fluoro-4-methoxyphenyl)benzaldehyde. InChIKey: GQGLQEUFJZBPIJ-UHFFFAOYSA-N.
| Molecular formula | C14H11FO2 |
|---|---|
| Molecular weight | 230.23 g/mol |
| IUPAC name | 4-(3-fluoro-4-methoxyphenyl)benzaldehyde |
| InChIKey | GQGLQEUFJZBPIJ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=CC=C(C=C2)C=O)F |
Computed by PubChem (NCBI)