Products 71760-76-4
CAS 71760-76-4 appears in our catalog under these names: 1,4-Butanediol-d10, 98 atom % D, min 98% Chemical Purity, 1,4-Butanediol-d10, D10-1,4-Butanediol. Offered by: CDN, Biosynth, HPC Standards. Available pack sizes: 1g, 0,5g, 1x100mg.
1,1,2,2,3,3,4,4-octadeuterio-1,4-dideuteriooxybutane (CAS 71760-76-4) is a chemical compound with the molecular formula C4H10O2 and a molecular weight of 100.18 g/mol. IUPAC name: 1,1,2,2,3,3,4,4-octadeuterio-1,4-dideuteriooxybutane. InChIKey: WERYXYBDKMZEQL-MBXGXEIXSA-N.
| Molecular formula | C4H10O2 |
|---|---|
| Molecular weight | 100.18 g/mol |
| IUPAC name | 1,1,2,2,3,3,4,4-octadeuterio-1,4-dideuteriooxybutane |
| InChIKey | WERYXYBDKMZEQL-MBXGXEIXSA-N |
| SMILES | [2H]C([2H])(C([2H])([2H])C([2H])([2H])O[2H])C([2H])([2H])O[2H] |
Computed by PubChem (NCBI)