Products 74829-49-5
CAS 74829-49-5 appears in our catalog under these names: 1,4-Butane-d8-diol, 98 atom % D, min 98% Chemical Purity, 1,4-Butane-d8-diol, 1,4-BUTANDIOL-1,1,2,2,3,3,4,4-D8 98 ATOM, D8-1,4-Butandiol. Offered by: CDN, Biosynth, Sigma-Aldrich, HPC Standards. Available pack sizes: 1g, 0,5g, 100mg, 250mg, 1x10mg.
1,1,2,2,3,3,4,4-octadeuteriobutane-1,4-diol (CAS 74829-49-5) is a chemical compound with the molecular formula C4H10O2 and a molecular weight of 98.17 g/mol. IUPAC name: 1,1,2,2,3,3,4,4-octadeuteriobutane-1,4-diol. InChIKey: WERYXYBDKMZEQL-SVYQBANQSA-N.
| Molecular formula | C4H10O2 |
|---|---|
| Molecular weight | 98.17 g/mol |
| IUPAC name | 1,1,2,2,3,3,4,4-octadeuteriobutane-1,4-diol |
| InChIKey | WERYXYBDKMZEQL-SVYQBANQSA-N |
| SMILES | [2H]C([2H])(C([2H])([2H])C([2H])([2H])O)C([2H])([2H])O |
Computed by PubChem (NCBI)