CAS 71780-40-0 appears in our catalog under these names: Benzoic acid,3-hydroxy-4-(hydroxymethyl)-, methyl ester, 95%, 95%, 3-Hydroxy-4-hydroxymethyl-benzoic acid methyl ester, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
Methyl 3-hydroxy-4-(hydroxymethyl)benzoate (CAS 71780-40-0) is a chemical compound with the molecular formula C9H10O4 and a molecular weight of 182.17 g/mol. IUPAC name: methyl 3-hydroxy-4-(hydroxymethyl)benzoate. InChIKey: IPKROFXTOPMVEF-UHFFFAOYSA-N.
| Molecular formula | C9H10O4 |
|---|---|
| Molecular weight | 182.17 g/mol |
| IUPAC name | methyl 3-hydroxy-4-(hydroxymethyl)benzoate |
| InChIKey | IPKROFXTOPMVEF-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)CO)O |
Computed by PubChem (NCBI)