Products 717862-44-7

CAS 717862-44-7 is the registry number for 4-((4-(N-Cyclohexyl-N-methylsulfamoyl)phenyl)amino)-4-oxobutanoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-[4-[cyclohexyl(methyl)sulfamoyl]anilino]-4-oxobutanoic acid (CAS 717862-44-7) is a chemical compound with the molecular formula C17H24N2O5S and a molecular weight of 368.4 g/mol. IUPAC name: 4-[4-[cyclohexyl(methyl)sulfamoyl]anilino]-4-oxobutanoic acid. InChIKey: RAKNRAFXLULLDH-UHFFFAOYSA-N.

Identity
Molecular formulaC17H24N2O5S
Molecular weight368.4 g/mol
IUPAC name4-[4-[cyclohexyl(methyl)sulfamoyl]anilino]-4-oxobutanoic acid
InChIKeyRAKNRAFXLULLDH-UHFFFAOYSA-N
SMILESCN(C1CCCCC1)S(=O)(=O)C2=CC=C(C=C2)NC(=O)CCC(=O)O

Computed by PubChem (NCBI)