Products 7431-77-8
CAS 7431-77-8 appears in our catalog under these names: Sinapine thiocyanate, 95%, Sinapine Thiocyanate, >95% (HPLC), Sinapine thiocyanate/ 98%, Sinapine thiocyanate, Sinapine thiocyanate. Offered by: Combi-blocks, TRC, TargetMol, GLPBio, Biosynth. Available pack sizes: 100mg, 250mg, 10mg, 25mg, 50mg, 10mM (in 1ml dmso), 200mg, 1g.
2-[(E)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoyl]oxyethyl-trimethylazanium thiocyanate (CAS 7431-77-8) is a chemical compound with the molecular formula C17H24N2O5S and a molecular weight of 368.4 g/mol. IUPAC name: 2-[(E)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoyl]oxyethyl-trimethylazanium thiocyanate. InChIKey: YLELSNOPYHTYTB-UHFFFAOYSA-N.
| Molecular formula | C17H24N2O5S |
|---|---|
| Molecular weight | 368.4 g/mol |
| IUPAC name | 2-[(E)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoyl]oxyethyl-trimethylazanium thiocyanate |
| InChIKey | YLELSNOPYHTYTB-UHFFFAOYSA-N |
| SMILES | C[N+](C)(C)CCOC(=O)/C=C/C1=CC(=C(C(=C1)OC)O)OC.C(#N)[S-] |
Computed by PubChem (NCBI)