Products 717863-53-1
CAS 717863-53-1 is the registry number for N-(2-Ethoxyphenyl)-4-methyl-3-[[(4-methylphenyl)amino]sulfonyl]benzamide, 95%. Offered by: Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg.
N-(2-ethoxyphenyl)-4-methyl-3-[(4-methylphenyl)sulfamoyl]benzamide (CAS 717863-53-1) is a chemical compound with the molecular formula C23H24N2O4S and a molecular weight of 424.5 g/mol. IUPAC name: N-(2-ethoxyphenyl)-4-methyl-3-[(4-methylphenyl)sulfamoyl]benzamide. InChIKey: JCTQAQMMIBJHIS-UHFFFAOYSA-N.
| Molecular formula | C23H24N2O4S |
|---|---|
| Molecular weight | 424.5 g/mol |
| IUPAC name | N-(2-ethoxyphenyl)-4-methyl-3-[(4-methylphenyl)sulfamoyl]benzamide |
| InChIKey | JCTQAQMMIBJHIS-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=CC=C1NC(=O)C2=CC(=C(C=C2)C)S(=O)(=O)NC3=CC=C(C=C3)C |
Computed by PubChem (NCBI)