CAS 71884-56-5 is the registry number for Glycyl-D-proline. Offered by: TRC. Available pack sizes: 2,5g.
(2R)-1-(2-aminoacetyl)pyrrolidine-2-carboxylic acid (CAS 71884-56-5) is a chemical compound with the molecular formula C7H12N2O3 and a molecular weight of 172.18 g/mol. IUPAC name: (2R)-1-(2-aminoacetyl)pyrrolidine-2-carboxylic acid. InChIKey: KZNQNBZMBZJQJO-RXMQYKEDSA-N.
| Molecular formula | C7H12N2O3 |
|---|---|
| Molecular weight | 172.18 g/mol |
| IUPAC name | (2R)-1-(2-aminoacetyl)pyrrolidine-2-carboxylic acid |
| InChIKey | KZNQNBZMBZJQJO-RXMQYKEDSA-N |
| SMILES | C1C[C@@H](N(C1)C(=O)CN)C(=O)O |
Computed by PubChem (NCBI)