Products 71885-49-9

CAS 71885-49-9 is the registry number for 5-Ethoxy-3,3-dimethyl-5-oxopentanoic acid. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.

Structural formula: {0} (CAS {1})

5-ethoxy-3,3-dimethyl-5-oxopentanoic acid (CAS 71885-49-9) is a chemical compound with the molecular formula C9H16O4 and a molecular weight of 188.22 g/mol. IUPAC name: 5-ethoxy-3,3-dimethyl-5-oxopentanoic acid. InChIKey: ZBSFYDGELQITDN-UHFFFAOYSA-N.

Identity
Molecular formulaC9H16O4
Molecular weight188.22 g/mol
IUPAC name5-ethoxy-3,3-dimethyl-5-oxopentanoic acid
InChIKeyZBSFYDGELQITDN-UHFFFAOYSA-N
SMILESCCOC(=O)CC(C)(C)CC(=O)O

Computed by PubChem (NCBI)