CAS 71901-63-8 is the registry number for tert-Butyl 3-diazo-2-oxopropanoate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Tert-butyl 3-diazo-2-oxopropanoate (CAS 71901-63-8) is a chemical compound with the molecular formula C7H10N2O3 and a molecular weight of 170.17 g/mol. IUPAC name: tert-butyl 3-diazo-2-oxopropanoate. InChIKey: YSXHGTQUSBTHDI-UHFFFAOYSA-N.
| Molecular formula | C7H10N2O3 |
|---|---|
| Molecular weight | 170.17 g/mol |
| IUPAC name | tert-butyl 3-diazo-2-oxopropanoate |
| InChIKey | YSXHGTQUSBTHDI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C(=O)C=[N+]=[N-] |
Computed by PubChem (NCBI)