CAS 71921-91-0 appears in our catalog under these names: 3-Methyl-5-(S)-isopropyl Hydantoin, >95% (HPLC), 3-Methyl-5-(S)-isopropyl hydantoin. Offered by: TRC, Biosynth. Available pack sizes: 250mg, 500mg, 50mg, 0,5g, 0,25g, 1g, 2g, 5g.
(5S)-3-methyl-5-propan-2-ylimidazolidine-2,4-dione (CAS 71921-91-0) is a chemical compound with the molecular formula C7H12N2O2 and a molecular weight of 156.18 g/mol. IUPAC name: (5S)-3-methyl-5-propan-2-ylimidazolidine-2,4-dione. InChIKey: LMBVKYNWQBSNIR-YFKPBYRVSA-N.
| Molecular formula | C7H12N2O2 |
|---|---|
| Molecular weight | 156.18 g/mol |
| IUPAC name | (5S)-3-methyl-5-propan-2-ylimidazolidine-2,4-dione |
| InChIKey | LMBVKYNWQBSNIR-YFKPBYRVSA-N |
| SMILES | CC(C)[C@H]1C(=O)N(C(=O)N1)C |
Computed by PubChem (NCBI)