CAS 719277-27-7 is the registry number for α2AR agonist 2. Offered by: MedChemExpress. Available pack sizes: Get quote.
(1Z)-1-(3-ethyl-5-fluoro-1,3-benzothiazol-2-ylidene)propan-2-one (CAS 719277-27-7) is a chemical compound with the molecular formula C12H12FNOS and a molecular weight of 237.30 g/mol. IUPAC name: (1Z)-1-(3-ethyl-5-fluoro-1,3-benzothiazol-2-ylidene)propan-2-one. InChIKey: KZNPXNKNIBBYSS-SDQBBNPISA-N.
| Molecular formula | C12H12FNOS |
|---|---|
| Molecular weight | 237.30 g/mol |
| IUPAC name | (1Z)-1-(3-ethyl-5-fluoro-1,3-benzothiazol-2-ylidene)propan-2-one |
| InChIKey | KZNPXNKNIBBYSS-SDQBBNPISA-N |
| SMILES | CCN\1C2=C(C=CC(=C2)F)S/C1=C\C(=O)C |
Computed by PubChem (NCBI)